C23H32BrNO6 — CID 12000035
dipropan-2-yl 2-[7-bromo-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate (PubChem CID 12000035) has the molecular formula C23H32BrNO6 and a molecular weight of 498.41 g/mol. Its IUPAC name is dipropan-2-yl 2-[7-bromo-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate.
| Compound Name | dipropan-2-yl 2-[7-bromo-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate |
|---|---|
| PubChem CID | 12000035 |
| Molecular Formula | C23H32BrNO6 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | dipropan-2-yl 2-[7-bromo-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)C1c2cc(Br)ccc2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32BrNO6/c1-13(2)29-20(26)18(21(27)30-14(3)4)19-17-12-16(24)9-8-15(17)10-11-25(19)22(28)31-23(5,6)7/h8-9,12-14,18-19H,10-11H2,1-7H3 |
| InChIKey | QJJYVNWYWOSPIQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|