C25H37NO6 — CID 58402671
dipropan-2-yl 2-[(1R)-6,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate (PubChem CID 58402671) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is dipropan-2-yl 2-[(1R)-6,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate.
| Compound Name | dipropan-2-yl 2-[(1R)-6,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate |
|---|---|
| PubChem CID | 58402671 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | dipropan-2-yl 2-[(1R)-6,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]propanedioate |
| SMILES | Cc1cc2c(cc1C)[C@@H](C(C(=O)OC(C)C)C(=O)OC(C)C)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C25H37NO6/c1-14(2)30-22(27)20(23(28)31-15(3)4)21-19-13-17(6)16(5)12-18(19)10-11-26(21)24(29)32-25(7,8)9/h12-15,20-21H,10-11H2,1-9H3/t21-/m0/s1 |
| InChIKey | AOFAMOAUNRFMLE-NRFANRHFSA-N |
| XLogP | 4.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|