C21H32N4O5S2 — CID 12004573
N-[3-(diethylamino)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 12004573) has the molecular formula C21H32N4O5S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 12004573 |
| Molecular Formula | C21H32N4O5S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | CCN(CC)CCCNC(=O)CN1C(=O)CSc2ccc(S(=O)(=O)N3CCOCC3)cc21 |
| InChI | InChI=1S/C21H32N4O5S2/c1-3-23(4-2)9-5-8-22-20(26)15-25-18-14-17(6-7-19(18)31-16-21(25)27)32(28,29)24-10-12-30-13-11-24/h6-7,14H,3-5,8-13,15-16H2,1-2H3,(H,22,26) |
| InChIKey | VMZDBAVMXMKSDM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|