C20H15ClN2O2S — CID 12004925
4-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 12004925) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is 4-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 12004925 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)c2cc3c(Cl)nc4ccccc4c3s2)cc1 |
| InChI | InChI=1S/C20H15ClN2O2S/c1-23(12-7-9-13(25-2)10-8-12)20(24)17-11-15-18(26-17)14-5-3-4-6-16(14)22-19(15)21/h3-11H,1-2H3 |
| InChIKey | LZTJYQNYIOZDEW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|