C20H15ClN2O3S — CID 12004946
4-chloro-N-(3,4-dimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 12004946) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(3,4-dimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 12004946 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-chloro-N-(3,4-dimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(Cl)nc4ccccc4c3s2)cc1OC |
| InChI | InChI=1S/C20H15ClN2O3S/c1-25-15-8-7-11(9-16(15)26-2)22-20(24)17-10-13-18(27-17)12-5-3-4-6-14(12)23-19(13)21/h3-10H,1-2H3,(H,22,24) |
| InChIKey | RQGBASQSCCTIKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|