C24H24BrN3O3 — CID 12005344
N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methoxyanilino)propanamide (PubChem CID 12005344) has the molecular formula C24H24BrN3O3 and a molecular weight of 482.38 g/mol. Its IUPAC name is N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methoxyanilino)propanamide.
| Compound Name | N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 12005344 |
| Molecular Formula | C24H24BrN3O3 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methoxyanilino)propanamide |
| SMILES | COc1ccccc1NC(C)C(=O)NN=Cc1ccccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C24H24BrN3O3/c1-17(27-21-11-4-6-13-23(21)30-2)24(29)28-26-15-19-9-3-5-12-22(19)31-16-18-8-7-10-20(25)14-18/h3-15,17,27H,16H2,1-2H3,(H,28,29) |
| InChIKey | BPRUALHCBVHCOB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|