C24H23BrClN3O2 — CID 5226918
N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-chloro-2-methylanilino)propanamide (PubChem CID 5226918) has the molecular formula C24H23BrClN3O2 and a molecular weight of 500.82 g/mol. Its IUPAC name is N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-chloro-2-methylanilino)propanamide.
| Compound Name | N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-chloro-2-methylanilino)propanamide |
|---|---|
| PubChem CID | 5226918 |
| Molecular Formula | C24H23BrClN3O2 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | N-[[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-chloro-2-methylanilino)propanamide |
| SMILES | Cc1cc(Cl)ccc1NC(C)C(=O)NN=Cc1ccccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C24H23BrClN3O2/c1-16-12-21(26)10-11-22(16)28-17(2)24(30)29-27-14-19-7-3-4-9-23(19)31-15-18-6-5-8-20(25)13-18/h3-14,17,28H,15H2,1-2H3,(H,29,30) |
| InChIKey | WPJMQNDWTGLUGZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|