C24H24BrN3O2 — CID 51661266
(2R)-N-[(E)-[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methylanilino)propanamide (PubChem CID 51661266) has the molecular formula C24H24BrN3O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is (2R)-N-[(E)-[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methylanilino)propanamide.
| Compound Name | (2R)-N-[(E)-[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methylanilino)propanamide |
|---|---|
| PubChem CID | 51661266 |
| Molecular Formula | C24H24BrN3O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (2R)-N-[(E)-[2-[(3-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-methylanilino)propanamide |
| SMILES | Cc1ccccc1N[C@H](C)C(=O)N/N=C/c1ccccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C24H24BrN3O2/c1-17-8-3-5-12-22(17)27-18(2)24(29)28-26-15-20-10-4-6-13-23(20)30-16-19-9-7-11-21(25)14-19/h3-15,18,27H,16H2,1-2H3,(H,28,29)/b26-15+/t18-/m1/s1 |
| InChIKey | GLMVTVQTPRBKPQ-GTPWMTBTSA-N |
| XLogP | 5.29 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|