C22H23N3O4S — CID 12005484
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[[(E)-3-(4-ethylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide (PubChem CID 12005484) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[[(E)-3-(4-ethylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[[(E)-3-(4-ethylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 12005484 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[[(E)-3-(4-ethylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
| SMILES | CCc1ccc(C(=O)/C=C/Nc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-4-17-5-7-18(8-6-17)21(26)13-14-23-19-9-11-20(12-10-19)30(27,28)25-22-15(2)16(3)24-29-22/h5-14,23,25H,4H2,1-3H3/b14-13+ |
| InChIKey | UXDAOVPXEVJGSK-BUHFOSPRSA-N |
| XLogP | 4.46 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|