C23H20BrN3O2S2 — CID 12005542
[3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate;hydrobromide (PubChem CID 12005542) has the molecular formula C23H20BrN3O2S2 and a molecular weight of 514.47 g/mol. Its IUPAC name is [3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate;hydrobromide.
| Compound Name | [3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 12005542 |
| Molecular Formula | C23H20BrN3O2S2 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | [3-(3-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl] N,N'-diphenylcarbamimidothioate;hydrobromide |
| SMILES | Br.Cc1cccc(N2C(=O)SC(S/C(=N/c3ccccc3)Nc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C23H19N3O2S2.BrH/c1-16-9-8-14-19(15-16)26-20(27)21(30-23(26)28)29-22(24-17-10-4-2-5-11-17)25-18-12-6-3-7-13-18;/h2-15,21H,1H3,(H,24,25);1H |
| InChIKey | NCYZVLRBJFQQMN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|