C23H44BrNO3 — CID 12005609
(2-heptoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium bromide (PubChem CID 12005609) has the molecular formula C23H44BrNO3 and a molecular weight of 462.51 g/mol. Its IUPAC name is (2-heptoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium bromide.
| Compound Name | (2-heptoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium bromide |
|---|---|
| PubChem CID | 12005609 |
| Molecular Formula | C23H44BrNO3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (2-heptoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium bromide |
| SMILES | CCCCCCCOC(=O)C[N+](C)(C)CCOC1CC2CCC1(C)C2(C)C.[Br-] |
| InChI | InChI=1S/C23H44NO3.BrH/c1-7-8-9-10-11-15-27-21(25)18-24(5,6)14-16-26-20-17-19-12-13-23(20,4)22(19,2)3;/h19-20H,7-18H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | MWNRMKMARLMNCD-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|