C25H24N2O7 — CID 12006910
2-(1-hydroxybutan-2-yl)-5-[2-(1-hydroxybutan-2-yl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 12006910) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-(1-hydroxybutan-2-yl)-5-[2-(1-hydroxybutan-2-yl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(1-hydroxybutan-2-yl)-5-[2-(1-hydroxybutan-2-yl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12006910 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-(1-hydroxybutan-2-yl)-5-[2-(1-hydroxybutan-2-yl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | CCC(CO)N1C(=O)c2ccc(C(=O)c3ccc4c(c3)C(=O)N(C(CC)CO)C4=O)cc2C1=O |
| InChI | InChI=1S/C25H24N2O7/c1-3-15(11-28)26-22(31)17-7-5-13(9-19(17)24(26)33)21(30)14-6-8-18-20(10-14)25(34)27(23(18)32)16(4-2)12-29/h5-10,15-16,28-29H,3-4,11-12H2,1-2H3 |
| InChIKey | VNUKRUPZTJSKCV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|