C26H24N2O3S — CID 12011168
[9-(benzenesulfonyl)-6-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]-phenylmethanone (PubChem CID 12011168) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is [9-(benzenesulfonyl)-6-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]-phenylmethanone.
| Compound Name | [9-(benzenesulfonyl)-6-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 12011168 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [9-(benzenesulfonyl)-6-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-3-yl]-phenylmethanone |
| SMILES | Cn1c2c(c3cc(S(=O)(=O)c4ccccc4)ccc31)CCN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C26H24N2O3S/c1-27-24-13-12-21(32(30,31)20-10-6-3-7-11-20)18-23(24)22-14-16-28(17-15-25(22)27)26(29)19-8-4-2-5-9-19/h2-13,18H,14-17H2,1H3 |
| InChIKey | AHJMSNVSTIQJPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|