About 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine
5-pyridin-2-yl-1H-1,2,4-triazol-3-amine (PubChem CID 12011792) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 12011792 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2ccccn2)n1 |
| InChI | InChI=1S/C7H7N5/c8-7-10-6(11-12-7)5-3-1-2-4-9-5/h1-4H,(H3,8,10,11,12) |
| InChIKey | VPTQEOQBSABCKV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine (CID 12011792) is 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine is Nc1n[nH]c(-c2ccccn2)n1.
What is the InChIKey of 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine?
The InChIKey is VPTQEOQBSABCKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5/c8-7-10-6(11-12-7)5-3-1-2-4-9-5/h1-4H,(H3,8,10,11,12).
What are the key properties of 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine?
5-pyridin-2-yl-1H-1,2,4-triazol-3-amine has a molecular weight of 161.17 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 12011792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).