C7H7N5 — CID 12011792
5-pyridin-2-yl-1H-1,2,4-triazol-3-amine (PubChem CID 12011792) has the molecular formula C7H7N5 and a molecular weight of 161.17 g/mol. Its IUPAC name is 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 12011792 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2ccccn2)n1 |
| InChI | InChI=1S/C7H7N5/c8-7-10-6(11-12-7)5-3-1-2-4-9-5/h1-4H,(H3,8,10,11,12) |
| InChIKey | VPTQEOQBSABCKV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |