C14H16FNO3 — CID 12013126
(5-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-(4-fluorophenyl)methanone (PubChem CID 12013126) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (5-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-(4-fluorophenyl)methanone.
| Compound Name | (5-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 12013126 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (5-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-(4-fluorophenyl)methanone |
| SMILES | CCCCOC1CC(C(=O)c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C14H16FNO3/c1-2-3-8-18-13-9-12(16-19-13)14(17)10-4-6-11(15)7-5-10/h4-7,13H,2-3,8-9H2,1H3 |
| InChIKey | XAARUYHEJCSDFT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|