C14H21NO — CID 12015124
(Z)-2-(3-hydroxy-3,5,5-trimethylcyclohexen-1-yl)pent-2-enenitrile (PubChem CID 12015124) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (Z)-2-(3-hydroxy-3,5,5-trimethylcyclohexen-1-yl)pent-2-enenitrile.
| Compound Name | (Z)-2-(3-hydroxy-3,5,5-trimethylcyclohexen-1-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 12015124 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (Z)-2-(3-hydroxy-3,5,5-trimethylcyclohexen-1-yl)pent-2-enenitrile |
| SMILES | CC/C=C(\C#N)C1=CC(C)(O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H21NO/c1-5-6-11(9-15)12-7-13(2,3)10-14(4,16)8-12/h6,8,16H,5,7,10H2,1-4H3/b11-6+ |
| InChIKey | ZTZXZGNSPIESAS-IZZDOVSWSA-N |
| XLogP | 3.34 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|