C19H20O3 — CID 12021667
4,5-dimethoxy-3-methyl-1-phenyl-2H-naphthalen-1-ol (PubChem CID 12021667) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4,5-dimethoxy-3-methyl-1-phenyl-2H-naphthalen-1-ol.
| Compound Name | 4,5-dimethoxy-3-methyl-1-phenyl-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 12021667 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4,5-dimethoxy-3-methyl-1-phenyl-2H-naphthalen-1-ol |
| SMILES | COC1=C(C)CC(O)(c2ccccc2)c2cccc(OC)c21 |
| InChI | InChI=1S/C19H20O3/c1-13-12-19(20,14-8-5-4-6-9-14)15-10-7-11-16(21-2)17(15)18(13)22-3/h4-11,20H,12H2,1-3H3 |
| InChIKey | FBXGAFYIJIGXPE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |