C20H32O2 — CID 12022251
(3R,4S)-3-(2-phenylethyl)dodec-1-ene-3,4-diol (PubChem CID 12022251) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3R,4S)-3-(2-phenylethyl)dodec-1-ene-3,4-diol.
| Compound Name | (3R,4S)-3-(2-phenylethyl)dodec-1-ene-3,4-diol |
|---|---|
| PubChem CID | 12022251 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3R,4S)-3-(2-phenylethyl)dodec-1-ene-3,4-diol |
| SMILES | C=C[C@](O)(CCc1ccccc1)[C@@H](O)CCCCCCCC |
| InChI | InChI=1S/C20H32O2/c1-3-5-6-7-8-12-15-19(21)20(22,4-2)17-16-18-13-10-9-11-14-18/h4,9-11,13-14,19,21-22H,2-3,5-8,12,15-17H2,1H3/t19-,20-/m0/s1 |
| InChIKey | XIAKDQMLPNIGRW-PMACEKPBSA-N |
| XLogP | 4.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|