C12H13ClN2O — CID 1202306
(4S)-2-(4-chlorophenyl)-4-ethyl-5-methyl-4H-pyrazol-3-one (PubChem CID 1202306) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is (4S)-2-(4-chlorophenyl)-4-ethyl-5-methyl-4H-pyrazol-3-one.
| Compound Name | (4S)-2-(4-chlorophenyl)-4-ethyl-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 1202306 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (4S)-2-(4-chlorophenyl)-4-ethyl-5-methyl-4H-pyrazol-3-one |
| SMILES | CC[C@@H]1C(=O)N(c2ccc(Cl)cc2)N=C1C |
| InChI | InChI=1S/C12H13ClN2O/c1-3-11-8(2)14-15(12(11)16)10-6-4-9(13)5-7-10/h4-7,11H,3H2,1-2H3/t11-/m0/s1 |
| InChIKey | FJZFMFSNYMBILI-NSHDSACASA-N |
| XLogP | 3.09 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |