C20H16ClFN2O3 — CID 6373307
(Z)-3-(4-chlorophenyl)-2-[[1-(4-fluorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid (PubChem CID 6373307) has the molecular formula C20H16ClFN2O3 and a molecular weight of 386.81 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-2-[[1-(4-fluorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(4-chlorophenyl)-2-[[1-(4-fluorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6373307 |
| Molecular Formula | C20H16ClFN2O3 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-2-[[1-(4-fluorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
| SMILES | CC1=NN(c2ccc(F)cc2)C(=O)C1C/C(=C/c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C20H16ClFN2O3/c1-12-18(19(25)24(23-12)17-8-6-16(22)7-9-17)11-14(20(26)27)10-13-2-4-15(21)5-3-13/h2-10,18H,11H2,1H3,(H,26,27)/b14-10- |
| InChIKey | NYQVYZVBJLYIIS-UVTDQMKNSA-N |
| XLogP | 4.38 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|