C22H21BrN2O3 — CID 6373511
(Z)-3-(4-bromophenyl)-2-[[3-ethyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid (PubChem CID 6373511) has the molecular formula C22H21BrN2O3 and a molecular weight of 441.33 g/mol. Its IUPAC name is (Z)-3-(4-bromophenyl)-2-[[3-ethyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(4-bromophenyl)-2-[[3-ethyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6373511 |
| Molecular Formula | C22H21BrN2O3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (Z)-3-(4-bromophenyl)-2-[[3-ethyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
| SMILES | CCC1=NN(c2ccc(C)cc2)C(=O)C1C/C(=C/c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C22H21BrN2O3/c1-3-20-19(21(26)25(24-20)18-10-4-14(2)5-11-18)13-16(22(27)28)12-15-6-8-17(23)9-7-15/h4-12,19H,3,13H2,1-2H3,(H,27,28)/b16-12- |
| InChIKey | OGFYWTXWZUBXEY-VBKFSLOCSA-N |
| XLogP | 5.04 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|