C21H19BrN2O3 — CID 6373439
(Z)-3-(4-bromophenyl)-2-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid (PubChem CID 6373439) has the molecular formula C21H19BrN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is (Z)-3-(4-bromophenyl)-2-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(4-bromophenyl)-2-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6373439 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (Z)-3-(4-bromophenyl)-2-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]prop-2-enoic acid |
| SMILES | CC1=NN(c2ccc(C)cc2)C(=O)C1C/C(=C/c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C21H19BrN2O3/c1-13-3-9-18(10-4-13)24-20(25)19(14(2)23-24)12-16(21(26)27)11-15-5-7-17(22)8-6-15/h3-11,19H,12H2,1-2H3,(H,26,27)/b16-11- |
| InChIKey | YDSJWQDRAKUESR-WJDWOHSUSA-N |
| XLogP | 4.65 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|