C22H18ClN3O3 — CID 6370193
(Z)-2-[[1-(4-chlorophenyl)-3-ethyl-5-oxo-4H-pyrazol-4-yl]methyl]-3-(4-cyanophenyl)prop-2-enoic acid (PubChem CID 6370193) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is (Z)-2-[[1-(4-chlorophenyl)-3-ethyl-5-oxo-4H-pyrazol-4-yl]methyl]-3-(4-cyanophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[[1-(4-chlorophenyl)-3-ethyl-5-oxo-4H-pyrazol-4-yl]methyl]-3-(4-cyanophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6370193 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (Z)-2-[[1-(4-chlorophenyl)-3-ethyl-5-oxo-4H-pyrazol-4-yl]methyl]-3-(4-cyanophenyl)prop-2-enoic acid |
| SMILES | CCC1=NN(c2ccc(Cl)cc2)C(=O)C1C/C(=C/c1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C22H18ClN3O3/c1-2-20-19(21(27)26(25-20)18-9-7-17(23)8-10-18)12-16(22(28)29)11-14-3-5-15(13-24)6-4-14/h3-11,19H,2,12H2,1H3,(H,28,29)/b16-11- |
| InChIKey | JPUXVXRRQBULFA-WJDWOHSUSA-N |
| XLogP | 4.50 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|