C22H20ClFN2O3 — CID 6370190
(Z)-2-[[1-(4-chlorophenyl)-5-oxo-3-propyl-4H-pyrazol-4-yl]methyl]-3-(4-fluorophenyl)prop-2-enoic acid (PubChem CID 6370190) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is (Z)-2-[[1-(4-chlorophenyl)-5-oxo-3-propyl-4H-pyrazol-4-yl]methyl]-3-(4-fluorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[[1-(4-chlorophenyl)-5-oxo-3-propyl-4H-pyrazol-4-yl]methyl]-3-(4-fluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6370190 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (Z)-2-[[1-(4-chlorophenyl)-5-oxo-3-propyl-4H-pyrazol-4-yl]methyl]-3-(4-fluorophenyl)prop-2-enoic acid |
| SMILES | CCCC1=NN(c2ccc(Cl)cc2)C(=O)C1C/C(=C/c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C22H20ClFN2O3/c1-2-3-20-19(21(27)26(25-20)18-10-6-16(23)7-11-18)13-15(22(28)29)12-14-4-8-17(24)9-5-14/h4-12,19H,2-3,13H2,1H3,(H,28,29)/b15-12- |
| InChIKey | BMSUDWBKUHOWSU-QINSGFPZSA-N |
| XLogP | 5.16 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|