C19H26O4Se — CID 12025659
methyl (2S)-2-cyclohexyl-2-[(2R,3S)-3-phenylselanyloxolan-2-yl]oxyacetate (PubChem CID 12025659) has the molecular formula C19H26O4Se and a molecular weight of 397.37 g/mol. Its IUPAC name is methyl (2S)-2-cyclohexyl-2-[(2R,3S)-3-phenylselanyloxolan-2-yl]oxyacetate.
| Compound Name | methyl (2S)-2-cyclohexyl-2-[(2R,3S)-3-phenylselanyloxolan-2-yl]oxyacetate |
|---|---|
| PubChem CID | 12025659 |
| Molecular Formula | C19H26O4Se |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | methyl (2S)-2-cyclohexyl-2-[(2R,3S)-3-phenylselanyloxolan-2-yl]oxyacetate |
| SMILES | COC(=O)[C@@H](O[C@H]1OCC[C@@H]1[Se]c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H26O4Se/c1-21-18(20)17(14-8-4-2-5-9-14)23-19-16(12-13-22-19)24-15-10-6-3-7-11-15/h3,6-7,10-11,14,16-17,19H,2,4-5,8-9,12-13H2,1H3/t16-,17-,19+/m0/s1 |
| InChIKey | IMXBQOMPJAZBKI-JENIJYKNSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|