C20H20O4Se — CID 85350797
methyl 2-methoxy-2-(10-phenylselanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl)acetate (PubChem CID 85350797) has the molecular formula C20H20O4Se and a molecular weight of 403.34 g/mol. Its IUPAC name is methyl 2-methoxy-2-(10-phenylselanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl)acetate.
| Compound Name | methyl 2-methoxy-2-(10-phenylselanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl)acetate |
|---|---|
| PubChem CID | 85350797 |
| Molecular Formula | C20H20O4Se |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | methyl 2-methoxy-2-(10-phenylselanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl)acetate |
| SMILES | COC(=O)C(OC)C1C2OC(c3ccccc32)C1[Se]c1ccccc1 |
| InChI | InChI=1S/C20H20O4Se/c1-22-18(20(21)23-2)15-16-13-10-6-7-11-14(13)17(24-16)19(15)25-12-8-4-3-5-9-12/h3-11,15-19H,1-2H3 |
| InChIKey | QPVQLCWUWNKYPE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|