C24H26F3NO3S — CID 12026824
(3,5-ditert-butyl-2-isoquinolin-1-ylphenyl) trifluoromethanesulfonate (PubChem CID 12026824) has the molecular formula C24H26F3NO3S and a molecular weight of 465.54 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-isoquinolin-1-ylphenyl) trifluoromethanesulfonate.
| Compound Name | (3,5-ditert-butyl-2-isoquinolin-1-ylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12026824 |
| Molecular Formula | C24H26F3NO3S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (3,5-ditert-butyl-2-isoquinolin-1-ylphenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)c(-c2nccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H26F3NO3S/c1-22(2,3)16-13-18(23(4,5)6)20(19(14-16)31-32(29,30)24(25,26)27)21-17-10-8-7-9-15(17)11-12-28-21/h7-14H,1-6H3 |
| InChIKey | GOOIATDCUCKCCQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|