C10H18SSe — CID 12027141
(1Z)-1-butylsulfanyl-1-methylselanylpenta-1,4-diene (PubChem CID 12027141) has the molecular formula C10H18SSe and a molecular weight of 249.28 g/mol. Its IUPAC name is (1Z)-1-butylsulfanyl-1-methylselanylpenta-1,4-diene.
| Compound Name | (1Z)-1-butylsulfanyl-1-methylselanylpenta-1,4-diene |
|---|---|
| PubChem CID | 12027141 |
| Molecular Formula | C10H18SSe |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | (1Z)-1-butylsulfanyl-1-methylselanylpenta-1,4-diene |
| SMILES | C=CC/C=C(/SCCCC)[Se]C |
| InChI | InChI=1S/C10H18SSe/c1-4-6-8-10(12-3)11-9-7-5-2/h4,8H,1,5-7,9H2,2-3H3/b10-8- |
| InChIKey | UDWBVQPXAPVRGR-NTMALXAHSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|