C18H30S2Se2 — CID 100934747
(1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanylpenta-1,4-dienyl]diselanyl]penta-1,4-diene (PubChem CID 100934747) has the molecular formula C18H30S2Se2 and a molecular weight of 468.49 g/mol. Its IUPAC name is (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanylpenta-1,4-dienyl]diselanyl]penta-1,4-diene.
| Compound Name | (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanylpenta-1,4-dienyl]diselanyl]penta-1,4-diene |
|---|---|
| PubChem CID | 100934747 |
| Molecular Formula | C18H30S2Se2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | (1E)-1-butylsulfanyl-1-[[(1E)-1-butylsulfanylpenta-1,4-dienyl]diselanyl]penta-1,4-diene |
| SMILES | C=CC/C=C(\SCCCC)[Se][Se]/C(=C/CC=C)SCCCC |
| InChI | InChI=1S/C18H30S2Se2/c1-5-9-13-17(19-15-11-7-3)21-22-18(14-10-6-2)20-16-12-8-4/h5-6,13-14H,1-2,7-12,15-16H2,3-4H3/b17-13+,18-14+ |
| InChIKey | PNDJEJBLIMEZEJ-HBKJEHTGSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|