C11H20SSe — CID 101019944
(1Z)-1-butylsulfanyl-3-methyl-1-methylselanylpenta-1,4-diene (PubChem CID 101019944) has the molecular formula C11H20SSe and a molecular weight of 263.31 g/mol. Its IUPAC name is (1Z)-1-butylsulfanyl-3-methyl-1-methylselanylpenta-1,4-diene.
| Compound Name | (1Z)-1-butylsulfanyl-3-methyl-1-methylselanylpenta-1,4-diene |
|---|---|
| PubChem CID | 101019944 |
| Molecular Formula | C11H20SSe |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (1Z)-1-butylsulfanyl-3-methyl-1-methylselanylpenta-1,4-diene |
| SMILES | C=CC(C)/C=C(/SCCCC)[Se]C |
| InChI | InChI=1S/C11H20SSe/c1-5-7-8-12-11(13-4)9-10(3)6-2/h6,9-10H,2,5,7-8H2,1,3-4H3/b11-9- |
| InChIKey | OVYSKYXPPNBXDG-LUAWRHEFSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|