C13H22SSe — CID 15427338
4-[butylsulfanyl(methylselanyl)methylidene]hepta-1,6-diene (PubChem CID 15427338) has the molecular formula C13H22SSe and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[butylsulfanyl(methylselanyl)methylidene]hepta-1,6-diene.
| Compound Name | 4-[butylsulfanyl(methylselanyl)methylidene]hepta-1,6-diene |
|---|---|
| PubChem CID | 15427338 |
| Molecular Formula | C13H22SSe |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-[butylsulfanyl(methylselanyl)methylidene]hepta-1,6-diene |
| SMILES | C=CCC(CC=C)=C(SCCCC)[Se]C |
| InChI | InChI=1S/C13H22SSe/c1-5-8-11-14-13(15-4)12(9-6-2)10-7-3/h6-7H,2-3,5,8-11H2,1,4H3 |
| InChIKey | CHPOGEGOXFZTLM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|