C24H38S2Se2 — CID 101023744
4-[butylsulfanyl-[(1-butylsulfanyl-2-prop-2-enylpenta-1,4-dienyl)diselanyl]methylidene]hepta-1,6-diene (PubChem CID 101023744) has the molecular formula C24H38S2Se2 and a molecular weight of 548.62 g/mol. Its IUPAC name is 4-[butylsulfanyl-[(1-butylsulfanyl-2-prop-2-enylpenta-1,4-dienyl)diselanyl]methylidene]hepta-1,6-diene.
| Compound Name | 4-[butylsulfanyl-[(1-butylsulfanyl-2-prop-2-enylpenta-1,4-dienyl)diselanyl]methylidene]hepta-1,6-diene |
|---|---|
| PubChem CID | 101023744 |
| Molecular Formula | C24H38S2Se2 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 4-[butylsulfanyl-[(1-butylsulfanyl-2-prop-2-enylpenta-1,4-dienyl)diselanyl]methylidene]hepta-1,6-diene |
| SMILES | C=CCC(CC=C)=C(SCCCC)[Se][Se]C(SCCCC)=C(CC=C)CC=C |
| InChI | InChI=1S/C24H38S2Se2/c1-7-13-19-25-23(21(15-9-3)16-10-4)27-28-24(26-20-14-8-2)22(17-11-5)18-12-6/h9-12H,3-8,13-20H2,1-2H3 |
| InChIKey | YSDVMHWEXPQHPF-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|