C15H26SSe — CID 134923250
4-[butylsulfanyl(propan-2-ylselanyl)methylidene]hepta-1,6-diene (PubChem CID 134923250) has the molecular formula C15H26SSe and a molecular weight of 317.40 g/mol. Its IUPAC name is 4-[butylsulfanyl(propan-2-ylselanyl)methylidene]hepta-1,6-diene.
| Compound Name | 4-[butylsulfanyl(propan-2-ylselanyl)methylidene]hepta-1,6-diene |
|---|---|
| PubChem CID | 134923250 |
| Molecular Formula | C15H26SSe |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[butylsulfanyl(propan-2-ylselanyl)methylidene]hepta-1,6-diene |
| SMILES | C=CCC(CC=C)=C(SCCCC)[Se]C(C)C |
| InChI | InChI=1S/C15H26SSe/c1-6-9-12-16-15(17-13(4)5)14(10-7-2)11-8-3/h7-8,13H,2-3,6,9-12H2,1,4-5H3 |
| InChIKey | LTTPEKBCKRIVJB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|