C14H14O5 — CID 12027689
4,4,5,11-tetramethyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione (PubChem CID 12027689) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4,4,5,11-tetramethyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione.
| Compound Name | 4,4,5,11-tetramethyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione |
|---|---|
| PubChem CID | 12027689 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4,4,5,11-tetramethyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione |
| SMILES | Cc1cc2oc(=O)c3c(c2c(=O)o1)OC(C)(C)C3C |
| InChI | InChI=1S/C14H14O5/c1-6-5-8-10(13(16)17-6)11-9(12(15)18-8)7(2)14(3,4)19-11/h5,7H,1-4H3 |
| InChIKey | IKHWOQHOXURHDF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |