C15H16O5 — CID 12027690
4,4-diethyl-11-methyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione (PubChem CID 12027690) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4,4-diethyl-11-methyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione.
| Compound Name | 4,4-diethyl-11-methyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione |
|---|---|
| PubChem CID | 12027690 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4,4-diethyl-11-methyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),10-triene-7,13-dione |
| SMILES | CCC1(CC)Cc2c(c3c(=O)oc(C)cc3oc2=O)O1 |
| InChI | InChI=1S/C15H16O5/c1-4-15(5-2)7-9-12(20-15)11-10(19-13(9)16)6-8(3)18-14(11)17/h6H,4-5,7H2,1-3H3 |
| InChIKey | KZKZVPRXFSMBDX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |