C21H20O6 — CID 12050969
ethyl 4,6,8,9-tetramethyl-11,15-dioxo-10,14-dioxatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,12-pentaene-16-carboxylate (PubChem CID 12050969) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 4,6,8,9-tetramethyl-11,15-dioxo-10,14-dioxatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,12-pentaene-16-carboxylate.
| Compound Name | ethyl 4,6,8,9-tetramethyl-11,15-dioxo-10,14-dioxatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,12-pentaene-16-carboxylate |
|---|---|
| PubChem CID | 12050969 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | ethyl 4,6,8,9-tetramethyl-11,15-dioxo-10,14-dioxatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,12-pentaene-16-carboxylate |
| SMILES | CCOC(=O)C12C3=CC(=O)OC1(C)C(C)=c1c(C)cc(C)cc1=C2C(=O)O3 |
| InChI | InChI=1S/C21H20O6/c1-6-25-19(24)21-14-9-15(22)27-20(21,5)12(4)16-11(3)7-10(2)8-13(16)17(21)18(23)26-14/h7-9H,6H2,1-5H3 |
| InChIKey | MZZUDEOYUNUTCT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|