C18H22O4 — CID 177422787
8-ethyl-2,8,8a-trimethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione (PubChem CID 177422787) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 8-ethyl-2,8,8a-trimethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione.
| Compound Name | 8-ethyl-2,8,8a-trimethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 177422787 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 8-ethyl-2,8,8a-trimethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione |
| SMILES | CCC1(C)C2=C(C(=O)OC2=O)C(C(C)C)=C2C=C(C)OC21C |
| InChI | InChI=1S/C18H22O4/c1-7-17(5)14-13(15(19)21-16(14)20)12(9(2)3)11-8-10(4)22-18(11,17)6/h8-9H,7H2,1-6H3 |
| InChIKey | MDYNVUQUQUDIFW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|