C18H20O5 — CID 132540764
dimethyl (1S,10R,11S,12S)-15-oxatetracyclo[10.2.1.01,10.02,7]pentadeca-2(7),8,13-triene-10,11-dicarboxylate (PubChem CID 132540764) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is dimethyl (1S,10R,11S,12S)-15-oxatetracyclo[10.2.1.01,10.02,7]pentadeca-2(7),8,13-triene-10,11-dicarboxylate.
| Compound Name | dimethyl (1S,10R,11S,12S)-15-oxatetracyclo[10.2.1.01,10.02,7]pentadeca-2(7),8,13-triene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 132540764 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dimethyl (1S,10R,11S,12S)-15-oxatetracyclo[10.2.1.01,10.02,7]pentadeca-2(7),8,13-triene-10,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C=C[C@]3(O2)C2=C(C=C[C@@]13C(=O)OC)CCCC2 |
| InChI | InChI=1S/C18H20O5/c1-21-15(19)14-13-8-10-18(23-13)12-6-4-3-5-11(12)7-9-17(14,18)16(20)22-2/h7-10,13-14H,3-6H2,1-2H3/t13-,14-,17-,18-/m0/s1 |
| InChIKey | YODGCAQLFRCTEP-USJZOSNVSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|