C17H20O4 — CID 102181056
2,8,8,8a-tetramethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione (PubChem CID 102181056) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2,8,8,8a-tetramethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione.
| Compound Name | 2,8,8,8a-tetramethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 102181056 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,8,8,8a-tetramethyl-4-propan-2-ylfuro[3,4-f][1]benzofuran-5,7-dione |
| SMILES | CC1=CC2=C(C(C)C)C3=C(C(=O)OC3=O)C(C)(C)C2(C)O1 |
| InChI | InChI=1S/C17H20O4/c1-8(2)11-10-7-9(3)21-17(10,6)16(4,5)13-12(11)14(18)20-15(13)19/h7-8H,1-6H3 |
| InChIKey | WVEICGGHHBTNCT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|