C32H34O7 — CID 177346140
6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione;4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione (PubChem CID 177346140) has the molecular formula C32H34O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione;4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione.
| Compound Name | 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione;4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 177346140 |
| Molecular Formula | C32H34O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione;4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
| SMILES | CC1=C2C=CC(C(C)(C)C)=CC2C(C)(C)C2=C1C(=O)OC2=O.CC1=C2C=COC2C(C)(C)C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C19H22O3.C13H12O4/c1-10-12-8-7-11(18(2,3)4)9-13(12)19(5,6)15-14(10)16(20)22-17(15)21;1-6-7-4-5-16-10(7)13(2,3)9-8(6)11(14)17-12(9)15/h7-9,13H,1-6H3;4-5,10H,1-3H3 |
| InChIKey | ZIYXDWQXCSSPJF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|