C13H12O4 — CID 177346141
4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione (PubChem CID 177346141) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione.
| Compound Name | 4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 177346141 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4,8,8-trimethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
| SMILES | CC1=C2C=COC2C(C)(C)C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C13H12O4/c1-6-7-4-5-16-10(7)13(2,3)9-8(6)11(14)17-12(9)15/h4-5,10H,1-3H3 |
| InChIKey | RBJHZOONOJOJNM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|