C19H29NO7P2S2 — CID 12032780
5-[2,2-bis(diethoxyphosphoryl)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 12032780) has the molecular formula C19H29NO7P2S2 and a molecular weight of 509.52 g/mol. Its IUPAC name is 5-[2,2-bis(diethoxyphosphoryl)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[2,2-bis(diethoxyphosphoryl)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 12032780 |
| Molecular Formula | C19H29NO7P2S2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 5-[2,2-bis(diethoxyphosphoryl)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOP(=O)(OCC)C(C(c1ccccc1)C1SC(=S)NC1=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H29NO7P2S2/c1-5-24-28(22,25-6-2)18(29(23,26-7-3)27-8-4)15(14-12-10-9-11-13-14)16-17(21)20-19(30)31-16/h9-13,15-16,18H,5-8H2,1-4H3,(H,20,21,30) |
| InChIKey | IUUVCEPSPMDUHH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|