C38H26N6 — CID 12034142
4-[4-[3-[4-[4-(dimethylamino)phenyl]buta-1,3-diynyl]pyrazino[2,3-f][1,10]phenanthrolin-2-yl]buta-1,3-diynyl]-N,N-dimethylaniline (PubChem CID 12034142) has the molecular formula C38H26N6 and a molecular weight of 566.67 g/mol. Its IUPAC name is 4-[4-[3-[4-[4-(dimethylamino)phenyl]buta-1,3-diynyl]pyrazino[2,3-f][1,10]phenanthrolin-2-yl]buta-1,3-diynyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[3-[4-[4-(dimethylamino)phenyl]buta-1,3-diynyl]pyrazino[2,3-f][1,10]phenanthrolin-2-yl]buta-1,3-diynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 12034142 |
| Molecular Formula | C38H26N6 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 4-[4-[3-[4-[4-(dimethylamino)phenyl]buta-1,3-diynyl]pyrazino[2,3-f][1,10]phenanthrolin-2-yl]buta-1,3-diynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#CC#Cc2nc3c4cccnc4c4ncccc4c3nc2C#CC#Cc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H26N6/c1-43(2)29-21-17-27(18-22-29)11-5-7-15-33-34(16-8-6-12-28-19-23-30(24-20-28)44(3)4)42-38-32-14-10-26-40-36(32)35-31(37(38)41-33)13-9-25-39-35/h9-10,13-14,17-26H,1-4H3 |
| InChIKey | FJCCYJJLZAXEMD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|