C13H25NO3 — CID 12034962
tert-butyl N-[(2R)-2-hydroxy-3-methylideneheptyl]carbamate (PubChem CID 12034962) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-hydroxy-3-methylideneheptyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-hydroxy-3-methylideneheptyl]carbamate |
|---|---|
| PubChem CID | 12034962 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl N-[(2R)-2-hydroxy-3-methylideneheptyl]carbamate |
| SMILES | C=C(CCCC)[C@@H](O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-6-7-8-10(2)11(15)9-14-12(16)17-13(3,4)5/h11,15H,2,6-9H2,1,3-5H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | PNJRIRPVULCRKM-NSHDSACASA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|