C18H20N4O — CID 12035337
7-(3-anilinopropoxy)-5-methyl-1,8-naphthyridin-2-amine (PubChem CID 12035337) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 7-(3-anilinopropoxy)-5-methyl-1,8-naphthyridin-2-amine.
| Compound Name | 7-(3-anilinopropoxy)-5-methyl-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 12035337 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 7-(3-anilinopropoxy)-5-methyl-1,8-naphthyridin-2-amine |
| SMILES | Cc1cc(OCCCNc2ccccc2)nc2nc(N)ccc12 |
| InChI | InChI=1S/C18H20N4O/c1-13-12-17(22-18-15(13)8-9-16(19)21-18)23-11-5-10-20-14-6-3-2-4-7-14/h2-4,6-9,12,20H,5,10-11H2,1H3,(H2,19,21,22) |
| InChIKey | NBCZLDHVKDRTDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|