C25H46O3Si2 — CID 12037933
(3aS,7aS)-5,7-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,7a-tetrahydroinden-1-one (PubChem CID 12037933) has the molecular formula C25H46O3Si2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (3aS,7aS)-5,7-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,7a-tetrahydroinden-1-one.
| Compound Name | (3aS,7aS)-5,7-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 12037933 |
| Molecular Formula | C25H46O3Si2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (3aS,7aS)-5,7-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,3a,7a-tetrahydroinden-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1=C[C@@H]2CCC(=O)[C@@H]2C(CCO[Si](C)(C)C(C)(C)C)=C1 |
| InChI | InChI=1S/C25H46O3Si2/c1-24(2,3)29(7,8)27-15-13-19-17-20-11-12-22(26)23(20)21(18-19)14-16-28-30(9,10)25(4,5)6/h17-18,20,23H,11-16H2,1-10H3/t20-,23-/m0/s1 |
| InChIKey | BLURNSQJSHPSLG-REWPJTCUSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|