C19H17N3O3S — CID 1204155
2-[(2,3-dimethoxyphenyl)methylideneamino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 1204155) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methylideneamino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methylideneamino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 1204155 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methylideneamino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cccc(/C=N/c2ccccc2C(=O)Nc2nccs2)c1OC |
| InChI | InChI=1S/C19H17N3O3S/c1-24-16-9-5-6-13(17(16)25-2)12-21-15-8-4-3-7-14(15)18(23)22-19-20-10-11-26-19/h3-12H,1-2H3,(H,20,22,23)/b21-12+ |
| InChIKey | JJUIOZLROZXLJG-CIAFOILYSA-N |
| XLogP | 4.16 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|