About 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide
3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 721807) has the molecular formula C12H12N2O3S
and a molecular weight of 264.31 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 721807 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C12H12N2O3S/c1-16-9-4-3-8(7-10(9)17-2)11(15)14-12-13-5-6-18-12/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | GDGIKZDIFNTCHB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide (CID 721807) is 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide is COc1ccc(C(=O)Nc2nccs2)cc1OC.
What is the InChIKey of 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is GDGIKZDIFNTCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-16-9-4-3-8(7-10(9)17-2)11(15)14-12-13-5-6-18-12/h3-7H,1-2H3,(H,13,14,15).
What are the key properties of 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide?
3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 264.31 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 721807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).