C12H17IN6O4 — CID 12042147
(2R,3R,4R,5R)-2-[6-amino-8-(ethylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 12042147) has the molecular formula C12H17IN6O4 and a molecular weight of 436.21 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[6-amino-8-(ethylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[6-amino-8-(ethylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 12042147 |
| Molecular Formula | C12H17IN6O4 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (2R,3R,4R,5R)-2-[6-amino-8-(ethylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCNc1nc2c(N)nc(I)nc2n1[C@@H]1O[C@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17IN6O4/c1-2-15-12-16-5-8(14)17-11(13)18-9(5)19(12)10-7(22)6(21)4(3-20)23-10/h4,6-7,10,20-22H,2-3H2,1H3,(H,15,16)(H2,14,17,18)/t4-,6+,7-,10-/m1/s1 |
| InChIKey | HMLLRMNZCXDZRZ-GAWUUDPSSA-N |
| XLogP | -0.94 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|