C14H21IN6O4 — CID 86592815
(2R,3R,4S,5R)-2-[6-amino-8-(butylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 86592815) has the molecular formula C14H21IN6O4 and a molecular weight of 464.26 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-(butylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-(butylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 86592815 |
| Molecular Formula | C14H21IN6O4 |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-(butylamino)-2-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCNc1nc2c(N)nc(I)nc2n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H21IN6O4/c1-2-3-4-17-14-18-7-10(16)19-13(15)20-11(7)21(14)12-9(24)8(23)6(5-22)25-12/h6,8-9,12,22-24H,2-5H2,1H3,(H,17,18)(H2,16,19,20)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | JTOGPIFGQVUIEV-WOUKDFQISA-N |
| XLogP | -0.16 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|